|
|
| | 3-CHLORO-O-ANISIDINE 97 Basic information |
| Product Name: | 3-CHLORO-O-ANISIDINE 97 | | Synonyms: | 3-Chloro-2-methoxyaniline 95+%;3-CHLORO-O-ANISIDINE 97;Benzenamine, 3-chloro-2-methoxy-;Aniline, 3-chloro-2-methoxy-;3-Chloro-o-anisidine 97%;1-Amino-3-chloro-2-methoxybenzene;2-Methoxy-3-chloroaniline;2-Amino-6-chloroanisole (3-Chloro-2-methoxyaniline) | | CAS: | 51114-68-2 | | MF: | C7H8ClNO | | MW: | 157.6 | | EINECS: | | | Product Categories: | | | Mol File: | 51114-68-2.mol |  |
| | 3-CHLORO-O-ANISIDINE 97 Chemical Properties |
| Melting point | 179-180℃ (Decomposition) | | Boiling point | 112-116℃ (10 Torr) | | density | 1.234±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | liquid | | pka | 3.48±0.10(Predicted) | | color | Clear, dark red to tan | | InChI | InChI=1S/C7H8ClNO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,9H2,1H3 | | InChIKey | VPZJHTWLWKFPQW-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(Cl)=C1OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2921420090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-CHLORO-O-ANISIDINE 97 Usage And Synthesis |
| Uses | 3-Chloro-o-anisidine may be used in chemical synthesis studies. |
| | 3-CHLORO-O-ANISIDINE 97 Preparation Products And Raw materials |
|