| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | L-Aspartic acid-13C4, 15N, 99 atom % 13C Basic information |
| Product Name: | L-Aspartic acid-13C4, 15N, 99 atom % 13C | | Synonyms: | (S)-(+)-Aminosuccinic acid-13C4;(S)-Aminobutanedioic acid-13C4;13C Labeled L-aspartic acid;L-Aspartic-13C4 Acid;L-Aspartic acid-13C?;L-Aspartic acid-13C4;L-Aspartic acid (13C?, 99%);L-Aspartic acid-13C4, 15N, 99 atom % 13C | | CAS: | 55443-54-4 | | MF: | C4H7NO4 | | MW: | 133.10268 | | EINECS: | | | Product Categories: | | | Mol File: | 55443-54-4.mol |  |
| | L-Aspartic acid-13C4, 15N, 99 atom % 13C Chemical Properties |
| Melting point | >300°C (dec.) (lit.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Acid (Very Slightly), Aqueous Base (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +25.0°, c = 2 in 5 M HCl | | Stability: | Hygroscopic | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1+1,2+1,3+1,4+1 | | InChIKey | CKLJMWTZIZZHCS-UVYXLFMMSA-N | | SMILES | N[13C@@H]([13CH2][13C](O)=O)[13C](O)=O | | CAS Number Unlabeled | 56-84-8 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Aspartic acid-13C4, 15N, 99 atom % 13C Usage And Synthesis |
| Uses | L-Aspartic Acid (13C4, 99%) Microbiological/Pyrogen Tested. Labelled analogue of L-Aspartic Acid, a non-essential amino acid found in food sources. Aspartic Acid is one of the 20 proteinogenic amino acids; the building blocks of proteins. Its conjugate base L-aspartate is an excitatory neurotransmitter in the central nervous system. | | Definition | ChEBI: L-aspartic acid is the L-enantiomer of aspartic acid. It has a role as an Escherichia coli metabolite, a mouse metabolite and a neurotransmitter. It is an aspartate family amino acid, a proteinogenic amino acid, an aspartic acid and a L-alpha-amino acid. It is a conjugate acid of a L-aspartate(1-). It is an enantiomer of a D-aspartic acid. |
| | L-Aspartic acid-13C4, 15N, 99 atom % 13C Preparation Products And Raw materials |
|