| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939; 15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:Fluorescein o-acrylate
CAS:193419-86-2
Purity:95% Package:1g；250mg；100mg；5g
|
|
| | FLUORESCEIN O-ACRYLATE 97 Basic information |
| Product Name: | FLUORESCEIN O-ACRYLATE 97 | | Synonyms: | FLUORESCEIN O-ACRYLATE 97;Acryloyloxy fluorescein, 3-Acryloxyspirobenzo[c]-furan[1,9]xanthen-3-one;Fluorescein o-acrylate 95%;2-Propenoic acid, 6'-hydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3'-yl ester;(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate;Coclaurine Impurity 13;Fluorescein o-acrylate;-O-propyleneacidester | | CAS: | 193419-86-2 | | MF: | C23H14O6 | | MW: | 386.35 | | EINECS: | | | Product Categories: | | | Mol File: | 193419-86-2.mol |  |
| | FLUORESCEIN O-ACRYLATE 97 Chemical Properties |
| Melting point | 231-233 °C(lit.) | | Boiling point | 632.6±55.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.36±0.20(Predicted) | | form | solid | | λmax | 490 nm | | InChI | 1S/C23H14O6/c1-2-21(25)27-14-8-10-18-20(12-14)28-19-11-13(24)7-9-17(19)23(18)16-6-4-3-5-15(16)22(26)29-23/h2-12,24H,1H2 | | InChIKey | VYLDMXSRCVCHNE-UHFFFAOYSA-N | | SMILES | Oc1ccc2c(Oc3cc(OC(=O)C=C)ccc3C24OC(=O)c5ccccc45)c1 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-28-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | FLUORESCEIN O-ACRYLATE 97 Usage And Synthesis |
| Uses | Fluorescein o-acrylate can be used in the formation of fluorescent probes for application in bio-imaging. It can also be used in the synthesis of molecularly imprinted polymers (MIPs). It also facilitates the demarcation of different layers in fluorescence microscopy. | | General Description | Fluorescein o-acrylate is a fluorescent monomer with high quantum efficiency in aqueous media. Its excitation and emission wavelength are in the range of visible light. It can be copolymerized with a variety of monomers such as acrylic acid, styrene and acrylamide which facilitate the attachment of fluorescein with macromolecules. |
| | FLUORESCEIN O-ACRYLATE 97 Preparation Products And Raw materials |
|