| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:4-Ethoxy-3-Nitrobenzaldehyde
CAS:132390-61-5
Purity:99% Package:100mg;250mg;1g;5g;25g
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:4-Ethoxy-3-nitrobenzaldehyde
CAS:132390-61-5
Purity:98% Remarks:B34341
|
|
| | 4-ETHOXY-3-NITROBENZALDEHYDE 97 Basic information |
| | 4-ETHOXY-3-NITROBENZALDEHYDE 97 Chemical Properties |
| Melting point | 59-63 °C (lit.) | | storage temp. | 2-8°C, stored under nitrogen | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C9H9NO4/c1-2-14-9-4-3-7(6-11)5-8(9)10(12)13/h3-6H,2H2,1H3 | | InChIKey | RPJKVMCCDKVUJN-UHFFFAOYSA-N | | SMILES | CCOc1ccc(C=O)cc1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 4-ETHOXY-3-NITROBENZALDEHYDE 97 Usage And Synthesis |
| | 4-ETHOXY-3-NITROBENZALDEHYDE 97 Preparation Products And Raw materials |
|