|
|
| | (2-(piperidin-4-yl)phenyl)methanamine dihydrochloride Basic information |
| | (2-(piperidin-4-yl)phenyl)methanamine dihydrochloride Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C12H18N2.2ClH/c13-9-11-3-1-2-4-12(11)10-5-7-14-8-6-10;;/h1-4,10,14H,5-9,13H2;2*1H | | InChIKey | VBWHHONSCAVPOS-UHFFFAOYSA-N | | SMILES | NCC1=C(C=CC=C1)C2CCNCC2.Cl.Cl |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | (2-(piperidin-4-yl)phenyl)methanamine dihydrochloride Usage And Synthesis |
| Uses | (2-(Piperidin-4-yl)phenyl)methanamine dihydrochloride is a 4-aryl piperidine useful as a semi-flexible linker in PROTAC development for targeted protein degradation. Incorporation of rigidity into the linker region of bifunctional protein degraders may impact the 3D orientation of the degrader and thus ternary complex formation as well as optimization of drug-like properties. | | reaction suitability | reagent type: linker |
| | (2-(piperidin-4-yl)phenyl)methanamine dihydrochloride Preparation Products And Raw materials |
|