| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
| Products Intro: |
Product Name:1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- CAS:61382-01-2
|
| Company Name: |
Henan's chemical products co., LTD
|
| Tel: |
0371-60919097 15378766539; |
| Email: |
794449696@qq.com |
| Products Intro: |
Product Name:1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- CAS:61382-01-2 Purity:98% Package:25g 50g 100g 250g 500g
|
|
| | [1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- Basic information |
| Product Name: | [1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- | | Synonyms: | [1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino-;4,4'-diamino-[1,1'-biphenyl]-3,3'-dimethylnitrile;4,4'-Diamino-[1,1'-biphenyl]-3,3'-dicarbonitrile | | CAS: | 61382-01-2 | | MF: | C14H10N4 | | MW: | 234.26 | | EINECS: | | | Product Categories: | | | Mol File: | 61382-01-2.mol | ![[1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- Structure](CAS/GIF/61382-01-2.gif) |
| | [1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- Chemical Properties |
| Melting point | 291-293 °C (decomp) | | Boiling point | 476.2±45.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 1+-.0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C14H10N4/c15-7-11-5-9(1-3-13(11)17)10-2-4-14(18)12(6-10)8-16/h1-6H,17-18H2 | | InChIKey | JTLDSUFCRNXZNC-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C(C#N)=C2)=CC=C(N)C(C#N)=C1 |
| | [1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- Usage And Synthesis |
| | [1,1'-Biphenyl]-3,3'-dicarbonitrile, 4,4'-diamino- Preparation Products And Raw materials |
|