| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
Adenosine Impurity 1 manufacturers
|
| | Adenosine Impurity 1 Basic information |
| Product Name: | Adenosine Impurity 1 | | Synonyms: | Adenosine Impurity 1;Butanoic acid, 2-hydroxy-4-(methylsulfinyl)-;2-hydroxy-4 - (methylsulfinyl) butyric acid;2-hydroxy-4-methanesulfinylbutanoic acid;Methionine Impurity 7;Sorafenib Monomer;Adenosyl Methionine Impurity 10;Methionine Impurity 9 | | CAS: | 49540-14-9 | | MF: | C5H10O4S | | MW: | 166.2 | | EINECS: | | | Product Categories: | | | Mol File: | 49540-14-9.mol |  |
| | Adenosine Impurity 1 Chemical Properties |
| Boiling point | 499.6±35.0 °C(Predicted) | | density | 1.469±0.06 g/cm3(Predicted) | | pka | 3.54±0.10(Predicted) | | InChI | InChI=1S/C5H10O4S/c1-10(9)3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) | | InChIKey | OUSAZIQLZZRKJT-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(O)CCS(C)=O |
| | Adenosine Impurity 1 Usage And Synthesis |
| | Adenosine Impurity 1 Preparation Products And Raw materials |
|