|
|
| | 3-(3-AMINOPHENYL)PROPIONIC ACID Basic information |
| Product Name: | 3-(3-AMINOPHENYL)PROPIONIC ACID | | Synonyms: | 3-Aminobenzenepropanoicacid;3-aminophenylpropanoicacid;3-(3-AMINOPHENYL)PROPIONIC ACID;BETA-(3-AMINOPHENYL)PROPIONIC ACID;m-Aminohydrocinnamic acid;3-AMINOPHENYLPROPANOIC ACID / 3-(3-AMINOPHENYL)PROPIONIC ACID;3-amine benzyl propionic acid;3-(M-AMINOPHENYL)PROPIONIC ACID | | CAS: | 1664-54-6 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | 670-495-1 | | Product Categories: | Aromatic Propionic Acids | | Mol File: | 1664-54-6.mol |  |
| | 3-(3-AMINOPHENYL)PROPIONIC ACID Chemical Properties |
| Melting point | 99 °C | | Boiling point | 356.2±17.0 °C(Predicted) | | density | 1.217±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 4.71±0.10(Predicted) | | color | Light brown | | BRN | 2804090 | | InChI | InChI=1S/C9H11NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5,10H2,(H,11,12) | | InChIKey | SBHFVSXLYOBZKD-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=CC(N)=C1 | | CAS DataBase Reference | 1664-54-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 3-(3-AMINOPHENYL)PROPIONIC ACID Usage And Synthesis |
| Uses | 3-(3-Aminophenyl)propionic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. |
| | 3-(3-AMINOPHENYL)PROPIONIC ACID Preparation Products And Raw materials |
|