- Cyclobutanecarbonyl chloride
-
- $15.00 / 1KG
-
2021-07-13
- CAS:5006-22-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- Cyclobutanecarbonyl chloride
-
- $15.00 / 1KG
-
2021-07-10
- CAS:5006-22-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Cyclobutanecarbonyl chloride Basic information |
| Product Name: | Cyclobutanecarbonyl chloride | | Synonyms: | Cyclobutane carboxyl chloride;CYCLOBUTANE-1-CARBONYL CHLORIDE;CYCLOBUTANECARBONYL CHLORIDE;CYCLOBUTANECARBOXYLIC ACID CHLORIDE;Cyclobutanecarbonylchloride,98+%;Cyclobutanecarbonyl;cyclobutancarboxylic acid chloride;CYCLOBUTANE CARBONYL CHLORIDE 99% | | CAS: | 5006-22-4 | | MF: | C5H7ClO | | MW: | 118.56 | | EINECS: | 225-680-8 | | Product Categories: | Cycloalkanes | | Mol File: | 5006-22-4.mol |  |
| | Cyclobutanecarbonyl chloride Chemical Properties |
| Melting point | 151-152 °C | | Boiling point | 60 °C/50 mmHg (lit.) | | density | 1.039 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | 99 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless | | Sensitive | Moisture Sensitive | | BRN | 956624 | | InChI | InChI=1S/C5H7ClO/c6-5(7)4-2-1-3-4/h4H,1-3H2 | | InChIKey | JFWMYCVMQSLLOO-UHFFFAOYSA-N | | SMILES | C(Cl)(C1CCC1)=O | | CAS DataBase Reference | 5006-22-4(CAS DataBase Reference) | | NIST Chemistry Reference | Cyclobutanecarboxylic acid chloride(5006-22-4) |
| Hazard Codes | C,F | | Risk Statements | 10-34 | | Safety Statements | 26-36/37/39-45-16 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable/Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29162090 |
| | Cyclobutanecarbonyl chloride Usage And Synthesis |
| Chemical Properties | clear colourless liquid |
| | Cyclobutanecarbonyl chloride Preparation Products And Raw materials |
|