- 2-Phenyl-5-bromopyridine
-
- $200.00 / 1KG
-
2025-09-25
- CAS:27012-25-5
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 5-BROMO-2-PHENYLPYRIDINE Basic information |
| | 5-BROMO-2-PHENYLPYRIDINE Chemical Properties |
| Melting point | 73-75°C | | Boiling point | 309.3±22.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in ethyl ether. | | form | powder to crystal | | pka | 2.08±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C11H8BrN/c12-10-6-7-11(13-8-10)9-4-2-1-3-5-9/h1-8H | | InChIKey | PRNGIODVYLTUKH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=NC=C(Br)C=C1 |
| | 5-BROMO-2-PHENYLPYRIDINE Usage And Synthesis |
| Uses | 5-Bromo-2-phenylpyridine is used as a ligand in coordination chemistry and reacts with iridium(III) chloride to get in tris-heteroleptic Iridium(III), which finds application as phosphorescent (triplet) emitters in organic light-emitting diodes (OLEDs) due to its self-emitting nature, fast response, wide viewing angle and low power consumption. |
| | 5-BROMO-2-PHENYLPYRIDINE Preparation Products And Raw materials |
|