|
|
| | 4-(4-NITROPHENYL)MORPHOLIN-3-ONE Basic information |
| | 4-(4-NITROPHENYL)MORPHOLIN-3-ONE Chemical Properties |
| Boiling point | 516.8±45.0 °C(Predicted) | | density | 1.397 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -4.12±0.20(Predicted) | | color | Off-White to Yellow | | InChI | InChI=1S/C10H10N2O4/c13-10-7-16-6-5-11(10)8-1-3-9(4-2-8)12(14)15/h1-4H,5-7H2 | | InChIKey | OWMGEFWSGOTGAU-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCOCC1=O |
| Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 29349990 |
| | 4-(4-NITROPHENYL)MORPHOLIN-3-ONE Usage And Synthesis |
| Description | 4-(4-Nitrophenyl)morpholin-3-one is a nitro compound that has been shown to be magnetic and show an operational chemical formula. It has been studied in techniques such as magnetic resonance imaging (MRI) and X-ray crystallography. | | Chemical Properties | Yellow Solid | | Uses | Reagent used in the preparation of various Morpholine based pharmaceuticals. Rivaroxaban Impurity 52. | | Uses | 4-(4-Nitrophenyl)morpholin-3-one is a reagent used in the preparation of various Morpholine based pharmaceuticals. | | Application | 4-(4-Nitrophenyl)morpholin-3-one has also been used to synthesize nanowires, which are thin wires of semiconducting material that have a diameter of less than one micrometer. The synthesis can be done by pegylation, which attaches polyethylene glycol molecules to the molecule's surface. This technique is often used in biomedical applications because it prevents the molecule from being degraded by enzymes in the body. |
| | 4-(4-NITROPHENYL)MORPHOLIN-3-ONE Preparation Products And Raw materials |
|