|
|
| | Ethylenebis(oxyethylenenitrilo)tetraacetic acid Basic information | | Description |
| Product Name: | Ethylenebis(oxyethylenenitrilo)tetraacetic acid | | Synonyms: | 3,6-DIOXAOCTAMETHYLENEDINITRILOTETRAACETIC ACID;1,2-bis(2-dicarboxymethylaminoethoxy)ethane;12-diazatetradecanedioicacid,3,12-bis(carboxymethyl)-9-dioxa-3;6,9-Dioxa-3,12-diazatetradecanedioicacid,3,12-bis(carboxymethyl)-;9-Dioxa-3,12-diazatetradecanedioicacid,3,12-bis(carboxymethyl)-6;ebonta;ethylenedioxybis(ethyleneamino)tetraaceticacid;ETHYLENE GLYCOL BIS-(BETA-AMINOETHYLETHER)-N,N,N',N'-TETRAACETIC | | CAS: | 67-42-5 | | MF: | C14H24N2O10 | | MW: | 380.35 | | EINECS: | 200-651-2 | | Product Categories: | Analytical Chemistry;Chelating Reagents;Complexones;EDTA Analogs | | Mol File: | 67-42-5.mol |  |
| | Ethylenebis(oxyethylenenitrilo)tetraacetic acid Chemical Properties |
| Melting point | 241 °C (dec.)(lit.) | | Boiling point | 507.99°C (rough estimate) | | bulk density | 450kg/m3 | | density | 1.2838 (rough estimate) | | refractive index | 1.4590 (estimate) | | storage temp. | room temp | | solubility | 0.1 M NaOH: 0.1 M at 20 °C, clear, colorless | | pka | 1.47±0.10(Predicted) | | form | Crystalline Powder | | color | White | | biological source | synthetic (organic) | | Water Solubility | slightly soluble | | Merck | 14,3529 | | BRN | 1717370 | | InChI | 1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) | | InChIKey | DEFVIWRASFVYLL-UHFFFAOYSA-N | | SMILES | OC(=O)CN(CCOCCOCCN(CC(O)=O)CC(O)=O)CC(O)=O | | CAS DataBase Reference | 67-42-5(CAS DataBase Reference) | | EPA Substance Registry System | Ethylenebis(oxyethylenenitrilo)tetraacetic acid (67-42-5) | | Absorption | cut-off at 263nm in 1 M NaOH at 0.1M |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 2 | | RTECS | AH3760000 | | TSCA | TSCA listed | | HS Code | 29225000 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 orally in Rabbit: 3587 mg/kg |
| | Ethylenebis(oxyethylenenitrilo)tetraacetic acid Usage And Synthesis |
| Description | Ethylenebis(oxyethylenenitrilo)tetraacetic acid is also named as Egtazic acid. It works as a chelating agent for the determination of calcium in the presence of magnesium.
| | Chemical Properties | White to slightly off-white powder | | Uses | Pharmaceutic aid. EGTA. | | Uses | Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid is a chelating agent used for making complexes, especially for calcium ions, which help to determine calcium in the presence of magnesium. It can be used experimentally for treating animals possessing cerium poisoning. It is useful in the separation of thorium from monazite. It also acts as a buffer and is used in protein purification. | | Uses | A chelating agent useful for the determination of calcium in the presence of magnesium. | | Definition | ChEBI: A diether that is ethylene glycol in which the hydrogens of the hydroxy groups have been replaced by 2-[bis(carboxymethyl)amino]ethyl group respectively. | | reaction suitability | reagent type: chelator | | Biological Activity | Calcium chelator; protects against cell death caused by nitric oxide-induced calcium influx into nerve cells. | | Safety Profile | Poison by
intraperitoneal route. Moderately toxic by
ingestion. When heated to decomposition it
emits toxic fumes of NOx. See also
GLYCOL ETHERS. | | storage | Room temperature | | Purification Methods | Dissolve EGTA in aqueous NaOH, precipitate it by adding aqueous HCl, wash it with water and dry at 100o in vacuo.[Beilstein 4 IV 217.] |
| | Ethylenebis(oxyethylenenitrilo)tetraacetic acid Preparation Products And Raw materials |
|