|
|
| | 6-NITROCHROMONE Basic information |
| | 6-NITROCHROMONE Chemical Properties |
| Melting point | 172-175 °C (lit.) | | Boiling point | 347.1±42.0 °C(Predicted) | | density | 1.482±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Yellow to Green | | InChI | 1S/C9H5NO4/c11-8-3-4-14-9-2-1-6(10(12)13)5-7(8)9/h1-5H | | InChIKey | ORWADBVBOPTYQT-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc2OC=CC(=O)c2c1 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids |
| | 6-NITROCHROMONE Usage And Synthesis |
| | 6-NITROCHROMONE Preparation Products And Raw materials |
|