2,6-DICHLOROPHENOLINDOPHENOL manufacturers
- 2,6-DICHLOROPHENOLINDOPHENOL
-
- $8.00 / 1KG
-
2025-09-25
- CAS:956-48-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2,6-dichloroindophenol
-
- $0.00 / 1KG
-
2025-06-27
- CAS:956-48-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | 2,6-DICHLOROPHENOLINDOPHENOL Basic information |
| Product Name: | 2,6-DICHLOROPHENOLINDOPHENOL | | Synonyms: | 2,6-dichloroindophenol;PHENOLINDO-2,6-DICHLOROPHENOL;DCPIP;Dichloroindophenol;Dichlorophenolindphenol;Indochlorophenol;4-(3,5-dichloro-4-hydroxy-phenyl)iminocyclohexa-2,5-dien-1-one;4-(3,5-dichloro-4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one | | CAS: | 956-48-9 | | MF: | C12H7Cl2NO2 | | MW: | 268.1 | | EINECS: | 213-479-8 | | Product Categories: | | | Mol File: | 956-48-9.mol |  |
| | 2,6-DICHLOROPHENOLINDOPHENOL Chemical Properties |
| Boiling point | 393.5±42.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.49±0.30(Predicted) | | color | Dark Blue to Very Dark Blue | | Stability: | Hygroscopic | | InChI | InChI=1S/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H | | InChIKey | CCBICDLNWJRFPO-UHFFFAOYSA-N | | SMILES | C1(=O)C(Cl)=C/C(=N\C2=CC=C(O)C=C2)/C=C1Cl | | EPA Substance Registry System | 2,6-Dichloroindophenol (956-48-9) |
| | 2,6-DICHLOROPHENOLINDOPHENOL Usage And Synthesis |
| Uses | 2,6-Dichlorophenolindophenol (Technical Grade) is an organic redox dye, and is commonly used to assess ascorbic acid content. | | Definition | ChEBI: A quinone imine that is indophenol substituted by chloro groups at positions 2 and 6. |
| | 2,6-DICHLOROPHENOLINDOPHENOL Preparation Products And Raw materials |
|