|
|
| | Fmoc-3-(2-Naphthyl)-D-alanine Basic information |
| | Fmoc-3-(2-Naphthyl)-D-alanine Chemical Properties |
| Melting point | 191 °C | | Boiling point | 549.64°C (rough estimate) | | density | 1.2227 (rough estimate) | | refractive index | 1.6290 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly, Sonicated), DMF (Sparingly, Sonicated), DMSO (Slightly) | | form | Solid | | pka | 3.77±0.30(Predicted) | | color | White to Off-White | | Water Solubility | Slightly soluble in water. | | BRN | 7864489 | | Major Application | peptide synthesis | | InChIKey | JYUTZJVERLGMQZ-JKXWNSIXNA-N | | SMILES | C(C1C2=CC=CC=C2C2C=CC=CC1=2)OC(=O)N[C@@H](C(=O)O)CC1C=CC2=CC=CC=C2C=1 |&1:18,r| | | CAS DataBase Reference | 138774-94-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25-22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-3-(2-Naphthyl)-D-alanine Usage And Synthesis |
| Chemical Properties | off-white to light beige crystalline powder | | Uses | Fmoc-3-(2-naphthyl)-D-alanine is an intermediate used in the preparation of phosphoserine-containing tetrapeptides with hydrophobic N-terminal acyl groups as inhibitors of the BRCA1 protein. | | Uses | N-Fmoc-3-(2-naphthyl)-D-alanine is an Fmoc-protected alanine derivative and an intermediate used in the preparation of phosphoserine-containing tetrapeptides with hydrophobic N-terminal acyl groups as inhibitors of the BRCA1 protein. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-3-(2-Naphthyl)-D-alanine Preparation Products And Raw materials |
|