|
|
| | 2-BROMOHEPTAFLUOROPROPANE Basic information |
| Product Name: | 2-BROMOHEPTAFLUOROPROPANE | | Synonyms: | 2-BROMOHEPTAFLUOROPROPANE;2-Bromoheptafluoropropane 99%;2-Bromoheptafluoropropane99%;2-Bromo-1,1,1,2,3,3,3-heptafluoropropane;Perfluoro(2-bromopropane) 99%;Perfluoroisopropyl broMide;2-BromoheptafL;uoropropane | | CAS: | 422-77-5 | | MF: | C3BrF7 | | MW: | 248.92 | | EINECS: | | | Product Categories: | TOP1 | | Mol File: | 422-77-5.mol |  |
| | 2-BROMOHEPTAFLUOROPROPANE Chemical Properties |
| Boiling point | 14°C | | density | 1,8 g/cm3 | | vapor pressure | 960.8±0.0 mmHg at 25°C | | refractive index | 1.307 | | Fp | -35.1±18.4 °C | | InChI | InChI=1S/C3BrF7/c4-1(5,2(6,7)8)3(9,10)11 | | InChIKey | SULCAUVYSILBCB-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(Br)(F)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 23/24/25 | | Safety Statements | 36/37/39 | | RIDADR | 3163 | | Hazard Note | Irritant | | HazardClass | IRRITANT, GAS |
| | 2-BROMOHEPTAFLUOROPROPANE Usage And Synthesis |
| Uses | 2-Bromoheptafluoropropane is a key raw material intermediate for the synthesis of Broflanilide, which is a meta-diamide insecticide for the control of common crop pests, including Lepidoptera, Coleoptera, termites, mosquitoes and flies. Current studies show that Broflanilide has reported excellent insecticidal activity against larvae and adults. |
| | 2-BROMOHEPTAFLUOROPROPANE Preparation Products And Raw materials |
|