|
|
| | 4-Methylvaleryl chloride Basic information |
| Product Name: | 4-Methylvaleryl chloride | | Synonyms: | 4-methyl-pentanoylchlorid;4-METHYLVALEROYL CHLORIDE;4-METHYLVALERYL CHLORIDE;Isocapronyl chloride;G-METHYLVALEROYL CHLORIDE;Isocaproyl chloride;4-Methypentanoyl chloride;4-Methylpentanoic acid chloride | | CAS: | 38136-29-7 | | MF: | C6H11ClO | | MW: | 134.6 | | EINECS: | 253-801-4 | | Product Categories: | | | Mol File: | 38136-29-7.mol |  |
| | 4-Methylvaleryl chloride Chemical Properties |
| Boiling point | 144°C(lit.) | | density | 0.986±0.06 g/cm3(Predicted) | | refractive index | 1.4230 to 1.4270 | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C6H11ClO/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3 | | InChIKey | SVWCVXFHTHCJJB-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CCC(C)C | | EPA Substance Registry System | Pentanoyl chloride, 4-methyl- (38136-29-7) |
| RIDADR | UN 2920 8/3/PG II | | TSCA | TSCA listed | | HazardClass | 8/3 | | PackingGroup | II | | HS Code | 2914790090 |
| | 4-Methylvaleryl chloride Usage And Synthesis |
| Uses | 4-Methylpentanoyl Chloride is a reagent used in the preparation of novel AKR1C3 inhibitors as potential anti-cancer agents. |
| | 4-Methylvaleryl chloride Preparation Products And Raw materials |
|