| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Leancare Ltd. |
| Tel: |
+33 962096793 |
| Email: |
enquiry@leancare.co.uk |
|
| | 6,3'-Dimethoxy-3-hydroxyflavone Basic information |
| | 6,3'-Dimethoxy-3-hydroxyflavone Chemical Properties |
| form | solid | | InChI | 1S/C17H14O5/c1-20-11-5-3-4-10(8-11)17-16(19)15(18)13-9-12(21-2)6-7-14(13)22-17/h3-9,19H,1-2H3 | | InChIKey | WOEUTFRCQAFFOM-UHFFFAOYSA-N | | SMILES | COc1cccc(c1)C2=C(O)C(=O)c3cc(OC)ccc3O2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6,3'-Dimethoxy-3-hydroxyflavone Usage And Synthesis |
| | 6,3'-Dimethoxy-3-hydroxyflavone Preparation Products And Raw materials |
|