| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 1-(Piperidin-3-yl)-1H-benzo[d]imidazole hydrochloride Basic information |
| | 1-(Piperidin-3-yl)-1H-benzo[d]imidazole hydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C12H15N3.ClH/c1-2-6-12-11(5-1)14-9-15(12)10-4-3-7-13-8-10;/h1-2,5-6,9-10,13H,3-4,7-8H2;1H | | InChIKey | VERVQMRMWHPOJW-UHFFFAOYSA-N | | SMILES | Cl.C1CNCC(C1)n2cnc3ccccc23 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(Piperidin-3-yl)-1H-benzo[d]imidazole hydrochloride Usage And Synthesis |
| | 1-(Piperidin-3-yl)-1H-benzo[d]imidazole hydrochloride Preparation Products And Raw materials |
|