- 1,6-DIAMINOPYRENE
-
- $2.00 / 1kg
-
2019-07-06
- CAS:14923-84-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 1,6-DIAMINOPYRENE Basic information |
| Product Name: | 1,6-DIAMINOPYRENE | | Synonyms: | 1,6-pyrenediamine;1,6-DIAMINOPYRENE;Dyaminopyrene;4-13-00-00479 (Beilstein Handbook Reference);Pyrene-1,6-diamine;1,6-Diaminopyrene> | | CAS: | 14923-84-3 | | MF: | C16H12N2 | | MW: | 232.28 | | EINECS: | | | Product Categories: | Pyrenes | | Mol File: | 14923-84-3.mol |  |
| | 1,6-DIAMINOPYRENE Chemical Properties |
| Melting point | 230 °C | | Boiling point | 509.6±30.0 °C(Predicted) | | density | 1.394±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 4.82±0.30(Predicted) | | color | Yellow to Dark Green | | InChI | InChI=1S/C16H12N2/c17-13-8-4-10-2-6-12-14(18)7-3-9-1-5-11(13)16(10)15(9)12/h1-8H,17-18H2 | | InChIKey | OWJJRQSAIMYXQJ-UHFFFAOYSA-N | | SMILES | C1(N)=C2C3=C4C(C=C2)=CC=C(N)C4=CC=C3C=C1 |
| RTECS | UR2451000 | | HS Code | 2921.59.8090 |
| | 1,6-DIAMINOPYRENE Usage And Synthesis |
| Uses | 1,6-Pyrenediamine is an intermediate in the synthesis of 1,8-Dinitropyrene (D480270), one of the major mutagens found in contaminated sediments. 1,8-Dinitropyrene is a potential human carcinogen. 1,6-Pyrenediamine may be a possible carcinogen and mutagen. |
| | 1,6-DIAMINOPYRENE Preparation Products And Raw materials |
|