|
|
| | β-Nicotinamide adenine dinucleotide sodium salt Basic information |
| Product Name: | β-Nicotinamide adenine dinucleotide sodium salt | | Synonyms: | BETA-NICOTINAMIDE ADENINE DINUCLEOTIDE SODIUM SALT;BETA-NAD SODIUM SALT;BETA-DPN SODIUM SALT;COENZYME 1 SODIUM SALT;COZYMASE SODIUM SALT;DPN SODIUM SALT;DIPHOSPHOPYRIDINE NUCLEOTIDE SODIUM SALT;b-nicotinamideadeninedinucleotide*sodiumapprox | | CAS: | 20111-18-6 | | MF: | C21H28N7NaO14P2 | | MW: | 687.43 | | EINECS: | | | Product Categories: | | | Mol File: | 20111-18-6.mol |  |
| | β-Nicotinamide adenine dinucleotide sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: soluble-50 mg/mL, clear, colorless to faintly yellow | | form | Powder | | color | White to off-white | | PH | 4-6 | | Sensitive | Hygroscopic | | InChIKey | XAVRYEHNAGAWLY-LRANKJFRNA-N | | SMILES | [Na].NC(=O)C1=CC=C[N](=C1)C2OC(COP(O)(=O)OP(O)(=O)OCC3OC(C(O)C3O)n4cnc5c(N)ncnc45)C(O)C2O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | β-Nicotinamide adenine dinucleotide sodium salt Usage And Synthesis |
| Description | β-Nicotinamide adenine dinucleotide sodium is the most common form of NAD. NAD can be reduced to NADH during coupling with reactions which oxidize various organic substrates. NADH then passes to the inside of mitochondria where it donates the electrons it is carrying to the electron transport chain. In this manner, NAD acts as an intermediate energy storage compound that indirectly generates ATP. | | Chemical Properties | β-Nicotinamide adenine dinucleotide sodium salt is sensitive to air and light. It is hygroscopic and incompatible with strong oxidants. It irritates the skin. | | Uses | b-Nicotinamide adenine dinucleotide sodium salt dihydrate (CAS# 20111-18-6) is an adenine derivative and a dynamic compound. It has been used in the preparation of biochemical logic gates (XOR and AND), as well as carbon electrodes for electrochemical determination of NADH and ethanol. | | Application | β-Nicotinamide adenine dinucleotide sodium is the most common form of NAD. NAD can be reduced to NADH during coupling with reactions which oxidize various organic substrates. NADH then passes to the inside of mitochondria where it donates the electrons it is carrying to the electron transport chain. In this manner, NAD acts as an intermediate. | | Biological Activity | β-Nicotinamide adenine dinucleotide (NAD+) and β-Nicotinamide adenine dinucleotide, reduced (NADH) comprise a coenzyme redox pair (NAD+:NADH) involved in a wide range of enzyme catalyzed oxidation reduction reactions. In addition to its redox function, NAD+/NADH is a donor of ADP-ribose units in ADP-ribosylaton (ADP-ribosyltransferases; poly(ADP-ribose) polymerases ) reactions and a precursor of cyclic ADP-ribose (ADP-ribosyl cyclases). |
| | β-Nicotinamide adenine dinucleotide sodium salt Preparation Products And Raw materials |
|