|
|
| | 2,2,2'-TRIMETHYLPROPIONANILIDE Basic information |
| Product Name: | 2,2,2'-TRIMETHYLPROPIONANILIDE | | Synonyms: | N-Pivaloyl-o-toluidine,99%;N-Pivaloyl-o-toluidine2,2,2'-Trimethylpropionanilide;2,2,2'-Trimethylpropionanilide ,99%;N-Pivaloyl-o-toluidine, 99% 5GR;N-Pivaloyl-O-toluidine, GC 98%;N-(2-Chlorophenyl)-2,2-dimethylpropanamide;2,2,2'-TRIMETHYLPROPIONANILIDE;N-PIVALOYL-O-TOLUIDINE | | CAS: | 61495-04-3 | | MF: | C12H17NO | | MW: | 191.27 | | EINECS: | | | Product Categories: | Amides;Carbonyl Compounds;Organic Building Blocks | | Mol File: | 61495-04-3.mol |  |
| | 2,2,2'-TRIMETHYLPROPIONANILIDE Chemical Properties |
| Melting point | 111-115 °C | | Boiling point | 327.03°C (rough estimate) | | density | 1.0096 (rough estimate) | | refractive index | 1.5220 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 15.13±0.70(Predicted) | | form | Crystalline Powder | | color | White | | InChI | InChI=1S/C12H17NO/c1-9-7-5-6-8-10(9)13-11(14)12(2,3)4/h5-8H,1-4H3,(H,13,14) | | InChIKey | CSGRQLUGMVFNON-UHFFFAOYSA-N | | SMILES | C(NC1=CC=CC=C1C)(=O)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2,2'-TRIMETHYLPROPIONANILIDE Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2,2,2′-Trimethylpropionanilide (2,2,2-N-pivaloyl-o-toluidine) may be used to determine the concentration of lithium diisopropylamide mono(tetrahydrofuran) via titration. It may be used to determine the concentrations of alkyllithiums by titration, to the colorimetric endpoint, indicated by the persistence of a yellow color in the solution. |
| | 2,2,2'-TRIMETHYLPROPIONANILIDE Preparation Products And Raw materials |
|