|
|
| | Methyl piperidine-3-carboxylate Basic information |
| Product Name: | Methyl piperidine-3-carboxylate | | Synonyms: | MethylPiperidine-3-carboxylicacid;MethylNipecotate(Methyl3-piperidinecarboxylate);(RS)-3-piperidinecarboxilic acid methyl ester;Methyl (S)-nipecotate;nipecot methyl ester;methyl 3-piperidinecarboxylate;3-Piperidinecarboxylic acid, Methyl ester;3 - piperidine Methyl forMate | | CAS: | 50585-89-2 | | MF: | C7H13NO2 | | MW: | 143.18 | | EINECS: | 300-102-5 | | Product Categories: | pharmacetical | | Mol File: | 50585-89-2.mol |  |
| | Methyl piperidine-3-carboxylate Chemical Properties |
| Boiling point | 193.8±33.0 °C(Predicted) | | density | 1.021±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 9.28±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H13NO2/c1-10-7(9)6-3-2-4-8-5-6/h6,8H,2-5H2,1H3 | | InChIKey | BCDBHIAXYFPJCT-UHFFFAOYSA-N | | SMILES | N1CCCC(C(OC)=O)C1 | | CAS DataBase Reference | 50585-89-2(CAS DataBase Reference) |
| | Methyl piperidine-3-carboxylate Usage And Synthesis |
| | Methyl piperidine-3-carboxylate Preparation Products And Raw materials |
|