(R)-N-Fmoc-Allylglycine manufacturers
|
| | (R)-N-Fmoc-Allylglycine Basic information |
| | (R)-N-Fmoc-Allylglycine Chemical Properties |
| Melting point | 134 °C | | Boiling point | 473.68°C (rough estimate) | | density | 1.2486 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | 2-8°C | | pka | 3.72±0.10(Predicted) | | form | Solid | | color | White to off-white | | BRN | 7389283 | | Major Application | peptide synthesis | | InChI | InChI=1S/C20H19NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h2-6,8-11,17-18H,1,7,12H2,(H,21,24)(H,22,23)/t18-/m1/s1 | | InChIKey | YVBLQCANYSFEBN-GOSISDBHSA-N | | SMILES | C(O)(=O)[C@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC=C | | CAS DataBase Reference | 170642-28-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25-22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | (R)-N-Fmoc-Allylglycine Usage And Synthesis |
| Chemical Properties | white granular powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (R)-N-Fmoc-Allylglycine Preparation Products And Raw materials |
|