|
|
| | 2-NITRO-PYRIDIN-4-YLAMINE Basic information |
| | 2-NITRO-PYRIDIN-4-YLAMINE Chemical Properties |
| Boiling point | 382.3±22.0 °C(Predicted) | | density | 1.437±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.23±0.50(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C5H5N3O2/c6-4-1-2-7-5(3-4)8(9)10/h1-3H,(H2,6,7) | | InChIKey | ZPFUWAVLEWIOEJ-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=NC=CC(N)=C1 |
| | 2-NITRO-PYRIDIN-4-YLAMINE Usage And Synthesis |
| Uses | 2-Nitropyridin-4-amine is used in theoretical studies to identify the optical properties of pyridine and its substituted derivatives. |
| | 2-NITRO-PYRIDIN-4-YLAMINE Preparation Products And Raw materials |
|