| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:D-myo-Inositol 1,2,3,5,6-pentakis-phosphate
CAS:26326-85-2
Purity:>=80% (HPLC) Package:1mg Remarks:03181
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:D-myo-Inositol 1,2,3,5,6-pentakis-phosphate
CAS:26326-85-2
|
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Email: |
sales@carbosynth.com |
| Products Intro: |
Product Name:myo-Inositol 1,2,3,5,6-pentakisphosphate
CAS:26326-85-2
|
|
| | INS(1,2,3,5,6)P5 Basic information |
| Product Name: | INS(1,2,3,5,6)P5 | | Synonyms: | L-myo-Inositol 1,2,3,4,5-pentakis-phosphate;myo-D-Inositol pentakis(dihydrogen phosphate);L-myo-Inositol 1,2,3,4,5-pentakis(dihydrogen phosphate);D-MYO-INOSITOL-1,2,3,5,6-PENTAKISPHOSPHATE;INS(1,2,3,5,6)P5;D-myo-Inositol 1,2,3,5,6-pentaphosphate;D-myo-Inositol, 1,2,3,5,6-pentakis(dihydrogen phosphate);D-myo-Inositol 1,2,3,5,6-pentakis-phosphate | | CAS: | 26326-85-2 | | MF: | C6H17O21P5 | | MW: | 580.06 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | INS(1,2,3,5,6)P5 Chemical Properties |
| storage temp. | -20°C | | InChIKey | CTPQAXVNYGZUAJ-UOTPTPDRSA-N | | SMILES | O[C@@H]1[C@@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | INS(1,2,3,5,6)P5 Usage And Synthesis |
| Uses | myo-Inositol 1,2,3,5,6-pentakisphosphate regulates RNA polymerase I-mediated rRNA transcription in Saccharomyces cerevisiae. | | Definition | ChEBI: D-myo-inositol-1,2,3,5,6-pentaphosphate is an inositol phosphate. | | General Description | Aluminum was shown to increase the activity of multiple inositol polyphosphate phosphatathase(MIPP) in hepatic mammalian cells. This cased a decrease in the MIPP substrate, Ins(1,2,3,5,6)P5. | | Biochem/physiol Actions | The metabolite inositol is a precursor of inositides, which have an important impact on diverse areas of cellular regulation. |
| | INS(1,2,3,5,6)P5 Preparation Products And Raw materials |
|