|
|
| | 4-CYCLOPROPYL-2-FLUOROANILINE Basic information |
| Product Name: | 4-CYCLOPROPYL-2-FLUOROANILINE | | Synonyms: | AKOS BAR-1302;4-CYCLOPROPYL-2-FLUOROANILINE;4-Cyclopropyl-2-fluorophenylamine;Benzenamine, 4-cyclopropyl-2-fluoro-;4-cyclopropyl-2-fluoroaniline - [AC79932] | | CAS: | 893739-89-4 | | MF: | C9H10FN | | MW: | 151.18 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-CYCLOPROPYL-2-FLUOROANILINE Chemical Properties |
| Boiling point | 234.0±33.0 °C(Predicted) | | density | 1.220±0.06 g/cm3(Predicted) | | pka | 3.42±0.10(Predicted) | | InChI | InChI=1S/C9H10FN/c10-8-5-7(6-1-2-6)3-4-9(8)11/h3-6H,1-2,11H2 | | InChIKey | ORYUOTZNRAIMDX-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C2CC2)C=C1F |
| | 4-CYCLOPROPYL-2-FLUOROANILINE Usage And Synthesis |
| Uses | 4-Cyclopropyl-2-fluorophenylamine is used in of arylamide derivatives as RAF/MEK complex stabilizers and/or MEK inhibitors and antitumor agents. |
| | 4-CYCLOPROPYL-2-FLUOROANILINE Preparation Products And Raw materials |
|