- c-cbd iso late powder
-
- $860.00 / 1KG
-
2024-09-18
- CAS:321-21-1
- Min. Order: 0.5KG
- Purity: 99%
- Supply Ability: 500kg
|
| | 4-Fluoro-2-methylbenzoic acid Basic information |
| | 4-Fluoro-2-methylbenzoic acid Chemical Properties |
| Melting point | 168-172 °C (lit.) | | Boiling point | 265.6±20.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | pka | 3.86±0.25(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C8H7FO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | KDXOONIQRUZGSY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C=C1C | | CAS DataBase Reference | 321-21-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Fluoro-2-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Fluoro-2-methylbenzoic acid can be used in the production of medicines, dye carriers, plasticizers, fragrances and food preservatives. |
| | 4-Fluoro-2-methylbenzoic acid Preparation Products And Raw materials |
|