ROSAMICIN manufacturers
- Rosaramicin
-
- $1520.00 / 25mg
-
2026-01-05
- CAS:35834-26-5
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | ROSAMICIN Basic information |
| Product Name: | ROSAMICIN | | Synonyms: | ,12,16-tetramethyl-5,13-dioxo-9-((3,4,6-trideoxy-3-(dimethylamino)-beta-d-xylo;4,17-dioxabicyclo(14.1.0)heptadec-14-ene-10-acetaldehyde,3-ethyl-7-hydroxy-2,8;rosamicin from micromonospora rosaria;Rosamicin Micromonospora rosaria;JUVENIMICIN A3;frommicromonosporarosaria;JuvenimicinA3, Rosaramicin;4'-DeoxyCirramycin A1 | | CAS: | 35834-26-5 | | MF: | C31H51NO9 | | MW: | 581.74 | | EINECS: | 252-742-1 | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 35834-26-5.mol |  |
| | ROSAMICIN Chemical Properties |
| Melting point | 119-122° | | alpha | D26 -35° (ethanol) | | Boiling point | 640.04°C (rough estimate) | | density | 1.1598 (rough estimate) | | refractive index | 1.6310 (estimate) | | storage temp. | 2-8°C | | solubility | methanol: 10 mg/mL, clear, light yellow | | form | solid | | biological source | Micromonospora rosaria | | Merck | 13,8342 | | BRN | 1633003 | | InChIKey | IUPCWCLVECYZRV-JZMZINANSA-N | | SMILES | [H]C(=O)C[C@H]1C[C@@H](C)C(=O)\C=C\[C@]2(C)O[C@@]2([H])[C@H](C)[C@@H](CC)OC(=O)C[C@@H](O)[C@H](C)[C@H]1O[C@@H]3O[C@H](C)C[C@@H]([C@H]3O)N(C)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | JG6800000 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral | | Toxicity | LD50 in mice (mg/kg): 625 s.c.; 350 i.p.; 155 i.v. (Wagman) |
| | ROSAMICIN Usage And Synthesis |
| Uses | Antibacterial. | | Definition | ChEBI: A macrolide antibiotic with activity against Neisseria gonorrhoeae, Chlamydia trachomatis, Ureaplasma urealyticum and Mycoplasma hominis. | | Biochem/physiol Actions | Macrolide antibiotic similar to erythromycin, and with a similar spectrum of bactericidal activity. Against a wide variety of anaerobes, rosamicin is at least as potent as, and in some cases more potent than, erythromycin. |
| | ROSAMICIN Preparation Products And Raw materials |
|