|
|
| | beta-D-Galactose pentaacetate Basic information |
| Product Name: | beta-D-Galactose pentaacetate | | Synonyms: | Penta-O-acetyl-β-D-galactopyranose;beta-D-Galactose pen;Penta-O-acetyl-β-D-galactopyranose, 1,2,3,4,6-Penta-O-acetyl-β-D-galactopyranose;1,2,3,4,6-Penta-O-acetyl-β-D-galactopyranose, Penta-O-acetyl-β-D-galactopyranose;[(2S,3R,4S,5S,6R)-2,3,5-Triacetyloxy-6-(acetyloxymethyl)oxan-4-yl] acetate;D-Galactose pentaacetate ,98%;Acetyl 2-O,3-O,4-O,6-O-tetraacetyl-β-D-galactopyranoside;(2S,3R,4S,5S,6R)-6-(acetoxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate | | CAS: | 4163-60-4 | | MF: | C16H22O11 | | MW: | 390.34 | | EINECS: | 224-008-0 | | Product Categories: | Sugars, Carbohydrates & Glucosides;Biochemistry;Galactose;O-Substituted Sugars;Sugars;carbohydrate;Glycon Biochem;4163-60-4 | | Mol File: | 4163-60-4.mol |  |
| | beta-D-Galactose pentaacetate Chemical Properties |
| Melting point | 143-144 °C(lit.) | | alpha | 25 º (c=10,CHCl3,on dry ba) | | Boiling point | 435.58°C (rough estimate) | | density | 1.3984 (rough estimate) | | refractive index | 23.5 ° (C=2, MeOH) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | methanol: 50 mg/mL, clear | | form | powder | | color | White | | Water Solubility | Soluble in methanol (50 mg/ml), chloroform, and water. | | BRN | 98853 | | InChI | InChI=1/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13+,14+,15-,16-/s3 | | InChIKey | LPTITAGPBXDDGR-FTTYHUIRNA-N | | SMILES | [C@@H]1(OC(=O)C)[C@@H](OC(=O)C)[C@@H](O[C@H](COC(=O)C)[C@@H]1OC(=O)C)OC(=O)C |&1:0,5,10,12,18,r| | | CAS DataBase Reference | 4163-60-4(CAS DataBase Reference) | | EPA Substance Registry System | .beta.-D-Galactopyranose, pentaacetate (4163-60-4) |
| | beta-D-Galactose pentaacetate Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | It is used as a pharmaceutical intermediates. |
| | beta-D-Galactose pentaacetate Preparation Products And Raw materials |
|