- L-Asp(OBzl)-OBzlTos
-
- $0.00 / 1kg
-
2026-05-19
- CAS:2886-33-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Aspartic acid dibenzyl ester 4-toluenesulfonate Basic information |
| | L-Aspartic acid dibenzyl ester 4-toluenesulfonate Chemical Properties |
| Melting point | 157-160 °C(lit.) | | alpha | 9 º (c=1 in chloroform) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, DMSO, Methanol | | form | Powder | | color | Pale brown | | InChIKey | HLMUYZYLPUHSNV-NTISSMGPSA-N | | SMILES | Cc1ccc(cc1)S(O)(=O)=O.N[C@@H](CC(=O)OCc2ccccc2)C(=O)OCc3ccccc3 | | CAS DataBase Reference | 2886-33-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10-21 | | HS Code | 29224999 | | Storage Class | 13 - Non Combustible Solids |
| | L-Aspartic acid dibenzyl ester 4-toluenesulfonate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | L-Aspartic Acid Dibenzyl Ester p-Toluenesulfonate Salt is used in the preparation of Betulinic Acid derivatives that show inhibition towards HIV. It is also used in the preparation of piperidine funct
ional amides which act as potent and highly selective human β3 agonists. |
| | L-Aspartic acid dibenzyl ester 4-toluenesulfonate Preparation Products And Raw materials |
|