- 2,4'-Dipyridine
-
- $148.00 / 25g
-
2026-04-16
- CAS:581-47-5
- Min. Order: 25g
- Purity: 0.97
- Supply Ability: 100kg
- 2,4'-DIPYRIDYL
-
- $1000.00 / 1KG
-
2019-07-06
- CAS:581-47-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
|
| | 2,4'-DIPYRIDYL Basic information |
| Product Name: | 2,4'-DIPYRIDYL | | Synonyms: | 2,4'-Dipyridyl,98%;4'-DiPYRIDYL;2,4'-Bipyridine
2,4'-Dipyridyl;2,4'-Bipyridine97%;2,4'-BIPYRIDYL;2,4'-DIPYRIDYL;4-PYRIDYLPYRIDINE;2,4''-DIPYRIDYL 97+% | | CAS: | 581-47-5 | | MF: | C10H8N2 | | MW: | 156.18 | | EINECS: | 209-467-7 | | Product Categories: | | | Mol File: | 581-47-5.mol |  |
| | 2,4'-DIPYRIDYL Chemical Properties |
| Melting point | 58-62 °C | | Boiling point | 280-282 °C | | density | 1.1922 (rough estimate) | | refractive index | 1.6057 (estimate) | | Fp | 281°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Sparingly), DMSO (Sparingly) | | pka | pK1:1.19(+2);pK2:4.77(+1) (20°C) | | form | Solid | | color | Off-White to Pale Brown | | InChI | InChI=1S/C10H8N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h1-8H | | InChIKey | RMHQDKYZXJVCME-UHFFFAOYSA-N | | SMILES | C1(C2C=CN=CC=2)=NC=CC=C1 | | CAS DataBase Reference | 581-47-5(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Bipyridyl(581-47-5) |
| Provider | Language |
|
ACROS
| English |
| | 2,4'-DIPYRIDYL Usage And Synthesis |
| Chemical Properties | light yellow to beige-brown cystalline powder | | Uses | 2,4''-Bipyridine is used in preparation of Iridium Heterocyclic complexes. | | Synthesis Reference(s) | Tetrahedron Letters, 33, p. 2199, 1992 DOI: 10.1016/0040-4039(92)88176-6 Synthesis, p. 564, 1986 DOI: 10.1055/s-1986-31705 |
| | 2,4'-DIPYRIDYL Preparation Products And Raw materials |
|