|
|
| | 3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Basic information |
| | 3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Chemical Properties |
| Melting point | 172-176 °C(lit.) | | Boiling point | 463.8±35.0 °C(Predicted) | | density | 1.378±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 14.08±0.10(Predicted) | | color | White to Almost white | | InChI | 1S/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) | | InChIKey | XQPBZIITFQHIDI-UHFFFAOYSA-N | | SMILES | Nc1cc(n[nH]1)-c2ccc(Cl)cc2 | | CAS DataBase Reference | 78583-81-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Usage And Synthesis |
| Definition | ChEBI: 3-(4-Chlorophenyl)-1H-pyrazol-5-amine is a member of pyrazoles and a ring assembly. | | Synthesis Reference(s) | Synthesis, p. 276, 1984 DOI: 10.1055/s-1984-30809 |
| | 3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Preparation Products And Raw materials |
|