- BOC-ALA-ONP
-
- $1.00 / 1KG
-
2019-07-06
- CAS:2483-49-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20kg
- BOC-ALA-ONP
-
- $1.00 / 1KG
-
2019-07-06
- CAS:2483-49-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | BOC-ALA-ONP Basic information |
| Product Name: | BOC-ALA-ONP | | Synonyms: | BOC-ALANINE-ONP;BOC-ALA-ONP;BOC-L-ALANINE-P-NITROPHENYL ESTER;BOC-L-ALANINE 4-NITROPHENYL ESTER;N-ALPHA-T-BOC-L-ALANINE-P-NITROPHENYL ESTER;N-TERT-BUTOXYCARBONYL-L-ALANINE-P-NITROPHENYL ESTER;4-nitrophenyl N-[(1,1-dimethylethoxy)carbonyl]-L-alaninate;boc-ala-onp96+% | | CAS: | 2483-49-0 | | MF: | C14H18N2O6 | | MW: | 310.3 | | EINECS: | 219-621-5 | | Product Categories: | | | Mol File: | 2483-49-0.mol |  |
| | BOC-ALA-ONP Chemical Properties |
| Melting point | 78 °C(Solv: methanol (67-56-1)) | | Boiling point | 460.9±30.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.87±0.46(Predicted) | | form | Powder | | color | Pale brown | | Sensitive | Light Sensitive | | BRN | 1892073 | | Major Application | peptide synthesis | | InChI | 1S/C14H18N2O6/c1-9(15-13(18)22-14(2,3)4)12(17)21-11-7-5-10(6-8-11)16(19)20/h5-9H,1-4H3,(H,15,18)/t9-/m0/s1 | | InChIKey | SUHFNHHZORGDFI-VIFPVBQESA-N | | SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc(cc1)[N+]([O-])=O |
| WGK Germany | 3 | | F | 8 | | Storage Class | 11 - Combustible Solids |
| | BOC-ALA-ONP Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-ALA-ONP Preparation Products And Raw materials |
|