DIISOPROPYL PHTHALATE manufacturers
- Diisopropyl phthalate
-
- $0.00 / 1removed
-
2026-01-06
- CAS:605-45-8
- Min. Order:
- Purity: 99.91%
- Supply Ability: 10g
- Diisopropyl Phthalate
-
- $9.80 / 1KG
-
2020-01-10
- CAS:605-45-8
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | DIISOPROPYL PHTHALATE Basic information |
| | DIISOPROPYL PHTHALATE Chemical Properties |
| Melting point | 20 °C | | Boiling point | 313.42°C (rough estimate) | | density | 1.063 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.490(lit.) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Liquid | | color | Colourless | | Water Solubility | 332.9mg/L(20 ºC) | | BRN | 1972723 | | Major Application | environmental | | InChI | 1S/C14H18O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h5-10H,1-4H3 | | InChIKey | QWDBCIAVABMJPP-UHFFFAOYSA-N | | SMILES | CC(C)OC(=O)c1ccccc1C(=O)OC(C)C | | EPA Substance Registry System | Diisopropyl phthalate (605-45-8) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-40 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | RTECS | TI1350000 | | TSCA | TSCA listed | | HS Code | 2917.34.0150 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Carc. 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DIISOPROPYL PHTHALATE Usage And Synthesis |
| Uses | Diisopropyl phthalate may be used as an analytical standard for the determination of the analyte in meter dose inhalers (MDI) and children′s plastic toys by gas chromatography-tandem mass spectrometry (GC-MS/MS) technique. | | Definition | ChEBI: Diisopropyl phthalate is a phthalate ester, a diester and an isopropyl ester. |
| | DIISOPROPYL PHTHALATE Preparation Products And Raw materials |
|