- 2-Chlorobenzyl bromide
-
- $100.00 / 1KG
-
2025-09-25
- CAS:611-17-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2-Chlorobenzyl bromide
-
- $0.00 / 1KG
-
2022-02-22
- CAS:611-17-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100 tons
|
| | 2-Chlorobenzyl bromide Basic information |
| Product Name: | 2-Chlorobenzyl bromide | | Synonyms: | Toluene, alpha-bromo-o-chloro-;Toluene,α-bromo-o-chloro-;alpha-bromo-o-chloro-toluen;alpha-bromo-o-chlorotoluene;benzylbromide,2-chloro;-Bromo-2-chlorotoluene;α-Bromo-o-chlorotoluene;2-Chlorobenzyl bromi | | CAS: | 611-17-6 | | MF: | C7H6BrCl | | MW: | 205.48 | | EINECS: | 210-257-2 | | Product Categories: | Benzyl | | Mol File: | 611-17-6.mol |  |
| | 2-Chlorobenzyl bromide Chemical Properties |
| Melting point | 83-84 °C | | Boiling point | 103-104 °C/10 mmHg (lit.) | | density | 1.583 g/mL at 25 °C (lit.) | | refractive index | 1.591-1.593 | | Fp | 108 °C | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | Liquid | | color | Clear yellow | | Specific Gravity | 1.583 | | Sensitive | Lachrymatory | | BRN | 386264 | | InChI | InChI=1S/C7H6BrCl/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 | | InChIKey | PURSZYWBIQIANP-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=CC=C1Cl | | CAS DataBase Reference | 611-17-6(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-(bromomethyl)-2-chloro-(611-17-6) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 45-36/37/39-26-28-27 | | RIDADR | 1760 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 | | Hazardous Substances Data | 611-17-6(Hazardous Substances Data) |
| | 2-Chlorobenzyl bromide Usage And Synthesis |
| Chemical Properties | Clear yellow liquid | | Uses | 2-Chlorobenzyl bromide participates in Hass-Bender oxidation as well as the Henry reaction. | | Synthesis Reference(s) | Synthetic Communications, 6, p. 109, 1976 DOI: 10.1080/00397917608072618 | | General Description | 2-Chlorobenzyl bromide participates in Hass-Bender oxidation as well as the Henry reaction. |
| | 2-Chlorobenzyl bromide Preparation Products And Raw materials |
|