NEOSOLANIOL manufacturers
- Neosolaniol
-
- $900.00 / 5mg
-
2026-03-12
- CAS:36519-25-2
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | NEOSOLANIOL Basic information |
| Product Name: | NEOSOLANIOL | | Synonyms: | 12,13-epoxy-4-beta,15-diacetoxy-3-alpha,8-alpha-dihydroxy-trichothec-9-en;4BETA,15-DIACETOXY-3ALPHA,8ALPHA-DIHYDROXY-12,13-EPOXYTRICHOTHEC-9-ENE;8-HYDROXYDIACETOXYSCIRPENOL;Solaniol NSC 197212 Neosolaniol;NEOSOLANIOL;NEOSOLANIOL FROM FUSARIUM SPECIES;Brn 3657281;Nsc 197212 | | CAS: | 36519-25-2 | | MF: | C19H26O8 | | MW: | 382.4 | | EINECS: | | | Product Categories: | | | Mol File: | 36519-25-2.mol |  |
| | NEOSOLANIOL Chemical Properties |
| Melting point | 171.5°C | | Boiling point | 420.3°C (rough estimate) | | density | 1.2248 (rough estimate) | | refractive index | 1.4430 (estimate) | | Fp | 2 °C | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.2 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml | | pka | 13.32±0.70(Predicted) | | form | Solid | | color | White to off-white | | Major Application | agriculture cleaning products cosmetics food and beverages personal care | | InChIKey | TVZHDVCTOCZDNE-WVJYZQHISA-N | | SMILES | CC(=O)OC[C@]12C[C@H](O)C(C)=C[C@H]1O[C@@H]3[C@H](O)[C@@H](OC(C)=O)[C@@]2(C)[C@]34CO4 |
| Hazard Codes | T+,Xn,F | | Risk Statements | 26/27/28-36-20/21/22-11 | | Safety Statements | 22-36/37/39-45-36/37-16-26 | | RIDADR | UN 2811 6.1/PG 1 | | WGK Germany | 3 | | RTECS | YD0080000 | | HazardClass | 6.1(a) | | PackingGroup | I | | HS Code | 29329990 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |
| | NEOSOLANIOL Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Neosolaniol is a mycotoxin produced by Fusarium species commonly found in wheat and maize. |
| | NEOSOLANIOL Preparation Products And Raw materials |
| Raw materials | Trichothec-9-en-8-one, 4,15-bis(acetyloxy)-12,13-epoxy-3-hydroxy-, (3α,4β)- (9CI)-->Trichothec-9-ene-3,4,8,15-tetrol, 12,13-epoxy-, 4,15-diacetate, (3α,4β,8β)- (9CI)-->T-2 TOXIN |
|