|
|
| | Pentamethylcyclopentadienyltitanium trichloride Basic information |
| | Pentamethylcyclopentadienyltitanium trichloride Chemical Properties |
| Melting point | 200 °C (dec.) (lit.) | | Boiling point | 190-220 °C(Press: 4-7 Torr) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | crystal | | color | red | | Water Solubility | reacts | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C10H15.3ClH.Ti/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H;/q;;;;+3/p-3 | | InChIKey | QCEOZLISXJGWSW-UHFFFAOYSA-K | | SMILES | [C]1([C](C)[C](C)[C](C)[C]1C)C.[Ti](Cl)(Cl)Cl |^1:0,1,3,5,7| | | CAS DataBase Reference | 12129-06-5(CAS DataBase Reference) | | NIST Chemistry Reference | «eta»5-Pentamethylcyclopentadienyl titanium trichloride(12129-06-5) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Pentamethylcyclopentadienyltitanium trichloride Usage And Synthesis |
| Description | Trichloro(pentamethylcyclopentadienyl)titanium(IV) is a versatile catalyst for transesterification reactions and styrene polymerization. | | Chemical Properties | Pentamethylcyclopentadienyl)titanium(IV) Trichloride is a red to bordeaux crystals. | | Uses | Pentamethylcyclopentadienyl)titanium(IV) Trichloride is used as a catalyst in Transesterification reactions and styrene polymerization. It is also used as Piano-stool catalyst. | | General Description | Pentamethylcyclopentadienyltitanium trichloride has been shown to have mononuclear structure and high molecular weight, which can be confirmed by its crystal x-ray diffraction pattern. It belongs to the class of syndiotactic compounds and has an MM value of 1.3 g/mol. It also has a high degree of crystallinity, which can be seen from its diffraction pattern on a hexamethylenetetramine plate. | | reaction suitability | core: titanium
reagent type: catalyst |
| | Pentamethylcyclopentadienyltitanium trichloride Preparation Products And Raw materials |
|