- 1,3-DIACETYLBENZENE
-
- $9.90
-
2026-03-20
- CAS:6781-42-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 5tons
- 1,3-Diacetylbenzene
-
-
2025-06-04
- CAS:6781-42-6
- Min. Order: 1kg
- Purity: 98%+
- Supply Ability: 1000000kg per Month
|
| | 1,3-DIACETYLBENZENE Basic information |
| Product Name: | 1,3-DIACETYLBENZENE | | Synonyms: | 1,3-DIACETYLBENZENE;M-DIACETYLBENZENE;M-ACETYL ACETOPHENONE;benzene-1,3-bis(acetyl);1,3-Diacetylbenzene,97%;1,1'-m-Phenylenebisethanone;1,3-Diacetylbenzene,99%;1,3-Diacetytlbenzene | | CAS: | 6781-42-6 | | MF: | C10H10O2 | | MW: | 162.19 | | EINECS: | 229-842-9 | | Product Categories: | Furans ,Coumarins;Aromatic Ketones (substituted);Carbonyl Compounds;C10;Ketones | | Mol File: | 6781-42-6.mol |  |
| | 1,3-DIACETYLBENZENE Chemical Properties |
| Melting point | 28-32 °C (lit.) | | Boiling point | 150-155 °C/15 mmHg (lit.) | | density | 1.0613 (rough estimate) | | refractive index | 1.5485-1.5505 | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Soluble in ethanol, benzene, chloroform. | | form | Liquid After Melting | | color | Clear slightly yellow | | BRN | 2042511 | | InChI | InChI=1S/C10H10O2/c1-7(11)9-4-3-5-10(6-9)8(2)12/h3-6H,1-2H3 | | InChIKey | VCHOFVSNWYPAEF-UHFFFAOYSA-N | | SMILES | C1(C(=O)C)=CC=CC(C(=O)C)=C1 | | CAS DataBase Reference | 6781-42-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29143990 | | Storage Class | 11 - Combustible Solids |
| | 1,3-DIACETYLBENZENE Usage And Synthesis |
| Chemical Properties | CLEAR SLIGHTLY YELLOW LIQUID AFTER MELTING | | Uses | 1,3-Diacetylbenzene was used in the preparation of polyhydroxylated analogs. It is an important raw material and intermediates in organic synthesis. | | General Description | 1,3-Diacetylbenzene is an δ-diketone. It induces neuropathological changes in the rodent central and peripheral nervous systems. |
| | 1,3-DIACETYLBENZENE Preparation Products And Raw materials |
|