|
|
| | METHYLSUCCINIC ANHYDRIDE Basic information | | Uses |
| Product Name: | METHYLSUCCINIC ANHYDRIDE | | Synonyms: | 2-Methylsuccinic anhydride;3,4-Dihydro-3-methyl-2,5-furandione;3-Methyldihydro-2,5-furandione;3-Methylsuccinic anhydride;Dihydro-3-methyl-2,5-furandione;dihydro-3-methyl-5-furandione;Succinic anhydride, methyl-;PYROTARTARIC ANHYDRIDE | | CAS: | 4100-80-5 | | MF: | C5H6O3 | | MW: | 114.1 | | EINECS: | 223-870-5 | | Product Categories: | | | Mol File: | 4100-80-5.mol |  |
| | METHYLSUCCINIC ANHYDRIDE Chemical Properties |
| Melting point | 33-35 °C (lit.) | | Boiling point | 238-240 °C (lit.) | | density | 1.22 g/mL at 25 °C (lit.) | | refractive index | 1.4630 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | color | Off-white | | InChI | InChI=1S/C5H6O3/c1-3-2-4(6)8-5(3)7/h3H,2H2,1H3 | | InChIKey | DFATXMYLKPCSCX-UHFFFAOYSA-N | | SMILES | O1C(=O)CC(C)C1=O | | LogP | -0.354 (est) | | EPA Substance Registry System | 2,5-Furandione, dihydro-3-methyl- (4100-80-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2932190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | METHYLSUCCINIC ANHYDRIDE Usage And Synthesis |
| Uses | 2-Methylsuccinic Anhydride is reported to be a pollutant which occurs as partially oxidized organic component in urban aerosol. | | Chemical Properties | Colorless to pale yellow liquid(or solid) | | Uses | 2-Methylsuccinic Anhydride is reported to be a pollutant which occurs as partially oxidized organic component in urban aerosol. | | Definition | ChEBI: A tetrahydrofurandione that is succinic anhydride substituted by a methyl group at position 3. |
| | METHYLSUCCINIC ANHYDRIDE Preparation Products And Raw materials |
|