|
|
| | Methoxymethyldiphenylamine Basic information |
| | Methoxymethyldiphenylamine Chemical Properties |
| Melting point | 80-83°C | | Boiling point | 171 °C / 4mmHg | | density | 1.089±0.06 g/cm3(Predicted) | | vapor pressure | 0.014Pa at 25℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | almost transparency in Toluene | | pka | 1.35±0.40(Predicted) | | form | powder to crystal | | color | White to Brown | | Water Solubility | 16.79mg/L at 25℃ | | InChI | InChI=1S/C14H15NO/c1-11-10-13(16-2)8-9-14(11)15-12-6-4-3-5-7-12/h3-10,15H,1-2H3 | | InChIKey | CYMPUOGZUXAIMY-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=CC=C2)=CC=C(OC)C=C1C | | LogP | 3.92 at 25℃ | | CAS DataBase Reference | 41317-15-1(CAS DataBase Reference) | | EPA Substance Registry System | 4-Methoxy-2-methyldiphenylamine (41317-15-1) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | TSCA | TSCA listed | | HS Code | 2922.29.8190 |
| | Methoxymethyldiphenylamine Usage And Synthesis |
| Description | Methoxymethyldiphenylamine is a useful research chemical. | | Uses | Methoxymethyldiphenylamine is a synthetic organic chemical used in the production of black color formers. | | Flammability and Explosibility | Not classified |
| | Methoxymethyldiphenylamine Preparation Products And Raw materials |
|