1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE manufacturers
|
| | 1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE Basic information |
| Product Name: | 1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE | | Synonyms: | RARECHEM AH CK 0143;BUTTPARK 75\08-79;4-(2-PIPERAZIN-1-YL-ETHYL)-MORPHOLINE;1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE;1-(2-MORPHOLINOETHYL)PIPERAZINE;1-[2-(4-MORPHOLINO)ETHYL]PIPERAZINE;1-[2-(Morpholin-4-yl)ethyl]piperazine,99%;1-(2-Morpholinoethyl)-piperazin | | CAS: | 4892-89-1 | | MF: | C10H21N3O | | MW: | 199.29 | | EINECS: | | | Product Categories: | | | Mol File: | 4892-89-1.mol | ![1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE Structure](CAS/GIF/4892-89-1.gif) |
| | 1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE Chemical Properties |
| Melting point | 36-38℃ | | Boiling point | 82-84 °C (0.37505 mmHg) | | density | 1.018±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Low Melting Crystals or Oil | | pka | 9.21±0.10(Predicted) | | color | White to light yellow | | InChI | InChI=1S/C10H21N3O/c1-3-12(4-2-11-1)5-6-13-7-9-14-10-8-13/h11H,1-10H2 | | InChIKey | SAJZEJMFAWZNCQ-UHFFFAOYSA-N | | SMILES | N1(CCN2CCNCC2)CCOCC1 | | CAS DataBase Reference | 4892-89-1(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | 1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE Usage And Synthesis |
| Chemical Properties | White to light yellow low melting crystals or oil |
| | 1-[2-(MORPHOLIN-4-YL)-ETHYL]-PIPERAZINE Preparation Products And Raw materials |
|