|
|
| | Fluvastatin methyl ester Basic information |
| Product Name: | Fluvastatin methyl ester | | Synonyms: | methyl (3r,5s,6e)-7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1h-indol-2-yl]-3,5-dihydroxy-6-heptenoate;FLUVASTATIN METHYL ESTER;t-Butyl(E)-3,5-dihydroxy-7-[3′-(4″-fluorophenyl)1′ -methylethyl-lndoi-2′-yl]-6-heptenoste;R*,S*-(E)]-(±)-7-[3-(4-FLUOROPHENYL)-1-(1-METHYLETHYL)-1H-INDOL-2-YL]-3,5-DIHYDROXY-6-HEPTENOIC ACID TERT BUTYL ESTER (FLUVASTATIN DIOL T-BUTYL ESTER);Fluvastatin methyl ester (Methyl (3R,5S,6E)-7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate);(3R,5S,6E)-rel-7-[3-(4-Fluorophenyl)-1-(1-Methylethyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic Acid Methyl Ester;[R*,S*-(E)]-(+/-)-7-[3-(4-Fluorophenyl)-1-(1-Methylethyl)
-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic Acid Methyl Ester;FLUVASTATIN DIOL T-BUTYL ESTER | | CAS: | 93957-53-0 | | MF: | C25H28FNO4 | | MW: | 425.49 | | EINECS: | | | Product Categories: | Aromatics;Chiral Reagents;Intermediates;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 93957-53-0.mol |  |
| | Fluvastatin methyl ester Chemical Properties |
| Melting point | 125-127°C | | Boiling point | 627.5±55.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 13.54±0.20(Predicted) | | color | Pale Yellow | | InChIKey | BOCZYIUKFAQNLG-FPRFYRODNA-N | | SMILES | C(OC)(=O)C[C@H](O)C[C@H](O)/C=C/C1=C(C2=CC=C(F)C=C2)C2=C(N1C(C)C)C=CC=C2 |&1:5,8,r| | | CAS DataBase Reference | 93957-53-0(CAS DataBase Reference) |
| | Fluvastatin methyl ester Usage And Synthesis |
| Uses | An intermediate for the selective synthesis of Fluvastatin (F601250). |
| | Fluvastatin methyl ester Preparation Products And Raw materials |
|