- 2,6-Difluorobenzyl alcohol
-
- $9.00 / 1KG
-
2025-09-25
- CAS:19064-18-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,6-Difluorobenzyl alcohol Basic information |
| | 2,6-Difluorobenzyl alcohol Chemical Properties |
| Melting point | 168.5-169 °C | | Boiling point | 88 °C | | density | 1.3 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.495(lit.) | | Fp | 192 °F | | storage temp. | 2-8°C | | pka | 13.41±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.300 | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 2501536 | | InChI | InChI=1S/C7H6F2O/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 | | InChIKey | LVICICZQETYOGS-UHFFFAOYSA-N | | SMILES | C1(CO)=C(F)C=CC=C1F | | CAS DataBase Reference | 19064-18-7(CAS DataBase Reference) | | NIST Chemistry Reference | 2,6-Difluorobenzyl alcohol(19064-18-7) |
| | 2,6-Difluorobenzyl alcohol Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 2,6-Difluorobenzyl alcohol is used to get 2-(bromomethyl)-1,3-difluorobenzene. |
| | 2,6-Difluorobenzyl alcohol Preparation Products And Raw materials |
|