|
|
| | EU(FOD)3 Basic information |
| Product Name: | EU(FOD)3 | | Synonyms: | EU(FOD)3;EU(FOD)3 HYDRATE;EUROPIUM III 6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATE;EUROPIUM(III)6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-OCTANEDIONATE;EUROPIUM-FOD;EUROPIUM (FOD)3;EUROPIUM TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATE);RESOLVE-AL(TM) EUFOD | | CAS: | 17631-68-4 | | MF: | C30H30EuF21O6 | | MW: | 1037.49 | | EINECS: | 241-616-1 | | Product Categories: | Other Metal | | Mol File: | 17631-68-4.mol |  |
| | EU(FOD)3 Chemical Properties |
| Melting point | 203-207 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | solid | | Appearance | Light yellow to yellow Solid | | Water Solubility | Soluble in organic solvents. Insoluble in water. | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/3C10H11F7O2.Eu/c3*1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h3*4,18H,1-3H3;/q;;;+3/p-3/b3*5-4-; | | InChIKey | PTQJQBFRLLGICD-VNGPFPIXSA-K | | SMILES | CC(C)(C)C(\O[Eu](O\C(=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)C)O\C(=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)C)=C\C(=O)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Europium, tris(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionato-.kappa.O,.kappa.O')- (17631-68-4) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | EU(FOD)3 Usage And Synthesis |
| Chemical Properties | off-white to yellow powder or granules | | Uses | Tris(6,?6,?7,?7,?8,?8,?8-?heptafluoro-?2,?2-?dimethyl-?3,?5-?octanedionato)?europium(III) is a reagent used in the stereoselective allylation of oxysuccinate derivatives. | | General Description | Enhances stereoselectivity in the radical-mediated allylation of oxysuccinate derivatives. | | reaction suitability | core: erbium
reagent type: catalyst |
| | EU(FOD)3 Preparation Products And Raw materials |
|