- 2,3,5-TRICHLOROPHENOL
-
- $1.00 / 1g
-
2020-01-13
- CAS:933-78-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 2,3,5-TRICHLOROPHENOL Basic information |
| Product Name: | 2,3,5-TRICHLOROPHENOL | | Synonyms: | 2.3.5-Trichlor;2,3,5-TRICHLOROPHENOL;2,3,5-TCP;2 3 5-TRICHLOROPHENOL PESTANAL;2,3,5-TRICHLOROPHENOL, 100MG, NEAT;2 3 5-TRICHLOROPHENOL 97%;Phenol, 2,3,5-trichloro-;2,3,5-tcp solution | | CAS: | 933-78-8 | | MF: | C6H3Cl3O | | MW: | 197.45 | | EINECS: | 213-272-2 | | Product Categories: | Alpha Sort;Chemical Class;ChloroAnalytical Standards;Halogenated;PhenolsVolatiles/ Semivolatiles;TP - TZ;T-ZAlphabetic | | Mol File: | 933-78-8.mol |  |
| | 2,3,5-TRICHLOROPHENOL Chemical Properties |
| Melting point | 57-60 °C | | Boiling point | 248-249 °C | | density | 1.5701 (rough estimate) | | refractive index | 1.5300 (estimate) | | Fp | 2 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 6.57±0.15(Predicted) | | color | White to Off-White | | Water Solubility | 771mg/L(25 ºC) | | BRN | 2046862 | | InChI | InChI=1S/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H | | InChIKey | WWGQHTJIFOQAOC-UHFFFAOYSA-N | | SMILES | C1(O)=CC(Cl)=CC(Cl)=C1Cl | | CAS DataBase Reference | 933-78-8(CAS DataBase Reference) | | EPA Substance Registry System | 2,3,5-Trichlorophenol (933-78-8) |
| Provider | Language |
|
ACROS
| English |
| | 2,3,5-TRICHLOROPHENOL Usage And Synthesis |
| Chemical Properties | white chunks | | Uses | 2,3,5-Trichlorophenol is a halogenated phenol with possible toxic effects. | | General Description | Long colorless needles or white chalky solid. | | Air & Water Reactions | Very hygroscopic. Insoluble in water. | | Reactivity Profile | 2,3,5-TRICHLOROPHENOL is incompatible with acid chlorides, acid anhydrides and oxidizing agents . | | Fire Hazard | Flash point data for 2,3,5-TRICHLOROPHENOL are not available; however, 2,3,5-TRICHLOROPHENOL is probably combustible. |
| | 2,3,5-TRICHLOROPHENOL Preparation Products And Raw materials |
|