Ac-LEHD-CMK manufacturers
- AC-LEHD-CMK
-
- $7.00
-
2020-02-18
- CAS:403848-57-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | Ac-LEHD-CMK Basic information |
| Product Name: | Ac-LEHD-CMK | | Synonyms: | CASPASE-9 INHIBITOR III;AC-LEU-GLU-HIS-ASP-CHLOROMETHYLKETONE;AC-LEU-GLU-HIS-ASP-CMK;L-Histidinamide, N-acetyl-L-leucyl-L-α-glutamyl-N-[(1S)-1-(carboxymethyl)-3-chloro-2-oxopropyl]-;Caspase-9 Inhibitor III(Ac-LEHD-CMK);N-Acetyl-L-leucyl-L-α-glutamyl-N-[(1S)-1-(carboxymethyl)-3-chloro-2-oxopropyl]-L-histidinamide;(4S,7S,10S,13S)-10-((1H-Imidazol-4-yl)methyl)-7-(2-carboxyethyl)-13-(2-chloroacetyl)-4-isobutyl-2,5,8,11-tetraoxo-3,6,9,12-tetraazapentadecan-15-oic acid;Ac-LEHD-CMK | | CAS: | 403848-57-7 | | MF: | C24H35ClN6O9 | | MW: | 587.02 | | EINECS: | | | Product Categories: | Caspase/Related Products | | Mol File: | Mol File |  |
| | Ac-LEHD-CMK Chemical Properties |
| Boiling point | 1113.4±65.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | water: 1 mg/mL || DMSO: 5 mg/mL | | pka | 3.91±0.19(Predicted) | | form | Powder | | color | White to off-white | | Water Solubility | water: 1mg/mL
DMSO: 5mg/mL | | InChIKey | JSRLQUNMFYXVQD-XSLAGTTESA-N | | SMILES | ClCC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)C)CC(C)C)CCC(=O)O)Cc1nc[nH]c1)CC(=O)O |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Ac-LEHD-CMK Usage And Synthesis |
| Uses | A potent and irreversible inhibitor of caspase-9 | | Biological Activity | Cell permeable: yes', 'Primary Target
caspase-9', 'Product does not compete with ATP.', 'Reversible: no', 'Target IC50: 70 nM against caspase-9 | | IC 50 | Caspase-9 |
| | Ac-LEHD-CMK Preparation Products And Raw materials |
|