|
|
| | (1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE Basic information |
| Product Name: | (1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE | | Synonyms: | (-)-CIS-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE;(3AR,6AS)-3,3A,6,6A-TETRAHYDRO-2H-1-OXAPENTALEN-2-ONE;(3AR,6AS)-3,3A,6,6A-TETRAHYDRO-2H-CYCLOPENTA[B]FURAN-2-ONE;(1S,5R)-2-Oxabicyclo[3.3.0]oct-6-en-3-one, >=99%;(3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one;(1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE;(1S,5R)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE;(1S,5R)-(-)-CIS-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE | | CAS: | 43119-28-4 | | MF: | C7H8O2 | | MW: | 124.14 | | EINECS: | 610-106-4 | | Product Categories: | | | Mol File: | 43119-28-4.mol | ![(1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE Structure](CAS/GIF/43119-28-4.gif) |
| | (1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE Chemical Properties |
| Melting point | 44-46 °C(lit.) | | Boiling point | 263.1℃ | | density | 1.196 | | refractive index | 1.4906 (estimate) | | Fp | 104.0℃ | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml,Ethanol: 15 mg/ml | | form | A crystalline solid | | color | Off-white to light yellow | | Optical Rotation | [α]22/D 103°, c = 1 in methanol | | BRN | 3537516 | | InChI | InChI=1S/C7H8O2/c8-7-4-5-2-1-3-6(5)9-7/h1-2,5-6H,3-4H2/t5-,6-/m0/s1 | | InChIKey | RYBPGUMSFWGGLP-WDSKDSINSA-N | | SMILES | O1C(=O)C[C@]2([H])C=CC[C@]12[H] |
| | (1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE Usage And Synthesis |
| Chemical Properties | white to beige or brownish crystalline powder | | Uses | (?)-G-Lactone is a synthetic intermediate useful for prostaglandins synthesis[1]. | | References | [1] Alphand, V, et al. Microbial Transformations 16. One-step synthesis of a pivotal prostaglandin chiral synthon via a highly enantioselective microbiological Baeyer-Villiger type reaction. Tetrahedron Lett. 30(28), 3663-3664 (1989). |
| | (1S,5R)-(-)-2-OXABICYCLO[3.3.0]OCT-6-EN-3-ONE Preparation Products And Raw materials |
|