|
|
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Basic information | | Uses |
| Product Name: | 2,6-Dibromo-4-(trifluoromethoxy)aniline | | Synonyms: | 3,5-Dibromo-4-(trifluoromethoxy)aniline;3.5-Dibromo-4-Aminotrifluoromethoxybenzen;3,5-Dibromo-4-Aminotrifluoromethoxy;3,5-DIBROMO-4-AMINOTRIFLUOROMETHOXY BENZENE 99+%;3,5-dibromo-5-AminoTrifluoromethoxybenzene;4-Amino-3,5-dibromotrifluoromethoxybenzene;2,6-Dibromo-4-(trifluoromethoxy)aniline 97%;2,6-Dibromo-4-(trifluoromethoxy)aniline97% | | CAS: | 88149-49-9 | | MF: | C7H4Br2F3NO | | MW: | 334.92 | | EINECS: | 201-805-1 | | Product Categories: | amine| alkyl bromide | | Mol File: | 88149-49-9.mol |  |
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Chemical Properties |
| Melting point | 70-74 °C(lit.) | | Boiling point | 65/0.1mm | | density | 2.036±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | -0.38±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C7H4Br2F3NO/c8-4-1-3(14-7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 | | InChIKey | JBSWOEGXMADXOU-UHFFFAOYSA-N | | SMILES | C1(N)=C(Br)C=C(OC(F)(F)F)C=C1Br | | CAS DataBase Reference | 88149-49-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-60-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29222990 |
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Usage And Synthesis |
| Uses | 2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides. | | Chemical Properties | Light pink powder | | Uses | 2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides. | | Synthesis | The general procedure for the synthesis of 2,6-dibromo-4-(trifluoromethoxy)aniline from p-trifluoromethoxyaniline was as follows: first, 156 g of the crystallized mother liquor containing sodium sulfate was filtered into a 250 mL four-necked flask and the stirring apparatus was started. Subsequently, 17.5 g (0.175 mol) of the reagent was slowly added dropwise, followed by 36.5 g of sodium bromide (0.354 mol) and 30 g (99% purity, 0.168 mol) of 4-trifluoromethoxyaniline. The temperature of the reaction system was adjusted to above 30 °C and the dropwise addition of 38 g of 35% hydrogen peroxide solution was started. During the dropwise addition, if the temperature increased to 50 °C, the reaction temperature was controlled between 50 and 55 °C by adjusting the dropwise acceleration of the coolant. After the dropwise addition was completed, the reaction temperature was maintained to drop and the reaction was continued to be held for 3 hours. Upon completion of the reaction, the system was cooled to about 30°C and the filtration operation was carried out. The resulting filter cake was dried to obtain 55.8 g of white crystals of 2,6-dibromo-4-trifluoromethoxyaniline, which was analyzed by high performance liquid chromatography (HPLC) with a purity of 99.6% and a yield of 99.2%. | | References | [1] Patent: CN106631839, 2017, A. Location in patent: Paragraph 0022-0033
[2] Organic Letters, 2011, vol. 13, # 20, p. 5636 - 5639 |
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Preparation Products And Raw materials |
|