|
|
| | H-LEU-PNA Basic information |
| Product Name: | H-LEU-PNA | | Synonyms: | (s)-pentanamid;2-Amino-4-methyl-N-(4-nitrophenyl)pentanamide;L-Leucine-p-nitroaniline;Pentanamide, 2-amino-4-methyl-N-(4-nitrophenyl)-, (S)-;LEU-PNA;LEUCINE-PNA;LEUCINE P-NITROANILIDE;L-LEUCINE-4-NITROANILIDE | | CAS: | 4178-93-2 | | MF: | C12H17N3O3 | | MW: | 251.28 | | EINECS: | 224-047-3 | | Product Categories: | | | Mol File: | 4178-93-2.mol |  |
| | H-LEU-PNA Chemical Properties |
| Melting point | 88-90 °C | | Boiling point | 394.44°C (rough estimate) | | density | 1.1711 (rough estimate) | | refractive index | 1.5290 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO (>100 mM), and methanol (>25 mM). | | form | Light yellow powder. | | Appearance | Light yellow to yellow Solid | | BRN | 2218433 | | InChI | 1S/C12H17N3O3/c1-8(2)7-11(13)12(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,8,11H,7,13H2,1-2H3,(H,14,16)/t11-/m0/s1 | | InChIKey | AXZJHDNQDSVIDR-NSHDSACASA-N | | SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 4178-93-2(CAS DataBase Reference) | | EPA Substance Registry System | Pentanamide, 2-amino-4-methyl-N-(4-nitrophenyl)-, (2S)- (4178-93-2) |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 22-24/25-36/37-26 | | WGK Germany | 3 | | F | 10-23 | | TSCA | TSCA listed | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | H-LEU-PNA Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | Substrate for the colorimetric determination of leucine aminopeptidase. | | Uses | H-Leu-pna is an inhibitor. |
| | H-LEU-PNA Preparation Products And Raw materials |
|